C12H10BrIN2O3 — CID 79784796
1-[(5-bromo-2-methoxyphenyl)methyl]-5-iodopyrimidine-2,4-dione (PubChem CID 79784796) has the molecular formula C12H10BrIN2O3 and a molecular weight of 437.03 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)methyl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79784796 |
| Molecular Formula | C12H10BrIN2O3 |
| Molecular Weight | 437.03 g/mol |
| Exact Mass | 435.89 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-5-iodopyrimidine-2,4-dione |
| SMILES | COc1ccc(Br)cc1Cn1cc(I)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H10BrIN2O3/c1-19-10-3-2-8(13)4-7(10)5-16-6-9(14)11(17)15-12(16)18/h2-4,6H,5H2,1H3,(H,15,17,18) |
| InChIKey | BUCJZMHPZNAUHV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.03 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|