C12H12BrN3O2 — CID 114380613
1-[(2-amino-4-bromophenyl)methyl]-5-methylpyrimidine-2,4-dione (PubChem CID 114380613) has the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. Its IUPAC name is 1-[(2-amino-4-bromophenyl)methyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2-amino-4-bromophenyl)methyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 114380613 |
| Molecular Formula | C12H12BrN3O2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 1-[(2-amino-4-bromophenyl)methyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(Cc2ccc(Br)cc2N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H12BrN3O2/c1-7-5-16(12(18)15-11(7)17)6-8-2-3-9(13)4-10(8)14/h2-5H,6,14H2,1H3,(H,15,17,18) |
| InChIKey | GULNVWIESFPWRH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|