C49H44N8O8 — CID 139204388
5-methyl-1-[[4-[tris[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]methyl]phenyl]methyl]pyrimidine-2,4-dione (PubChem CID 139204388) has the molecular formula C49H44N8O8 and a molecular weight of 872.94 g/mol. Its IUPAC name is 5-methyl-1-[[4-[tris[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]methyl]phenyl]methyl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[[4-[tris[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]methyl]phenyl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139204388 |
| Molecular Formula | C49H44N8O8 |
| Molecular Weight | 872.94 g/mol |
| Exact Mass | 872.33 |
| IUPAC Name | 5-methyl-1-[[4-[tris[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]methyl]phenyl]methyl]pyrimidine-2,4-dione |
| SMILES | Cc1cn(Cc2ccc(C(c3ccc(Cn4cc(C)c(=O)[nH]c4=O)cc3)(c3ccc(Cn4cc(C)c(=O)[nH]c4=O)cc3)c3ccc(Cn4cc(C)c(=O)[nH]c4=O)cc3)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C49H44N8O8/c1-29-21-54(45(62)50-41(29)58)25-33-5-13-37(14-6-33)49(38-15-7-34(8-16-38)26-55-22-30(2)42(59)51-46(55)63,39-17-9-35(10-18-39)27-56-23-31(3)43(60)52-47(56)64)40-19-11-36(12-20-40)28-57-24-32(4)44(61)53-48(57)65/h5-24H,25-28H2,1-4H3,(H,50,58,62)(H,51,59,63)(H,52,60,64)(H,53,61,65) |
| InChIKey | GWOINKPRGGQMGW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 219.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.94 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|