C10H9FN4O4 — CID 63578904
3-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carbohydrazide (PubChem CID 63578904) has the molecular formula C10H9FN4O4 and a molecular weight of 268.20 g/mol. Its IUPAC name is 3-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carbohydrazide.
| Compound Name | 3-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63578904 |
| Molecular Formula | C10H9FN4O4 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carbohydrazide |
| SMILES | NNC(=O)c1occc1Cn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H9FN4O4/c11-6-4-15(10(18)13-8(6)16)3-5-1-2-19-7(5)9(17)14-12/h1-2,4H,3,12H2,(H,14,17)(H,13,16,18) |
| InChIKey | SUHRWJFZWPLUHQ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|