C12H10F2N4O3 — CID 63558377
N-(2-amino-4-fluorophenyl)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 63558377) has the molecular formula C12H10F2N4O3 and a molecular weight of 296.23 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 63558377 |
| Molecular Formula | C12H10F2N4O3 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | Nc1cc(F)ccc1NC(=O)Cn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H10F2N4O3/c13-6-1-2-9(8(15)3-6)16-10(19)5-18-4-7(14)11(20)17-12(18)21/h1-4H,5,15H2,(H,16,19)(H,17,20,21) |
| InChIKey | NTBKFWRCEIWJMY-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|