C11H16FN3O4 — CID 15172520
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-aminohexanoate (PubChem CID 15172520) has the molecular formula C11H16FN3O4 and a molecular weight of 273.26 g/mol. Its IUPAC name is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-aminohexanoate.
| Compound Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-aminohexanoate |
|---|---|
| PubChem CID | 15172520 |
| Molecular Formula | C11H16FN3O4 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-aminohexanoate |
| SMILES | NCCCCCC(=O)OCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16FN3O4/c12-8-6-15(11(18)14-10(8)17)7-19-9(16)4-2-1-3-5-13/h6H,1-5,7,13H2,(H,14,17,18) |
| InChIKey | VTRFWFRVXJABQW-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|