About (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane (PubChem CID 158179056) has the molecular formula C11H16FN3O5
and a molecular weight of 289.26 g/mol. Its IUPAC name is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane.
Molecular Properties
| Compound Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane |
| PubChem CID | 158179056 |
| Molecular Formula | C11H16FN3O5 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane |
| SMILES | C.CNC(=O)CCC(=O)OCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12FN3O5.CH4/c1-12-7(15)2-3-8(16)19-5-14-4-6(11)9(17)13-10(14)18;/h4H,2-3,5H2,1H3,(H,12,15)(H,13,17,18);1H4 |
| InChIKey | FYIWIFPFFFTCFG-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane?
The IUPAC name of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane (CID 158179056) is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane.
What is the SMILES notation for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane?
The canonical SMILES for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane is C.CNC(=O)CCC(=O)OCn1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane?
The InChIKey is FYIWIFPFFFTCFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN3O5.CH4/c1-12-7(15)2-3-8(16)19-5-14-4-6(11)9(17)13-10(14)18;/h4H,2-3,5H2,1H3,(H,12,15)(H,13,17,18);1H4.
What are the key properties of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane?
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane has a molecular weight of 289.26 g/mol, XLogP of -0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 4-(methylamino)-4-oxobutanoate;methane is sourced from PubChem (CID 158179056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).