C8H12FN3O3 — CID 145209845
ethane;5-fluoro-N-methyl-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 145209845) has the molecular formula C8H12FN3O3 and a molecular weight of 217.20 g/mol. Its IUPAC name is ethane;5-fluoro-N-methyl-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | ethane;5-fluoro-N-methyl-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 145209845 |
| Molecular Formula | C8H12FN3O3 |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | ethane;5-fluoro-N-methyl-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | CC.CNC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H6FN3O3.C2H6/c1-8-5(12)10-2-3(7)4(11)9-6(10)13;1-2/h2H,1H3,(H,8,12)(H,9,11,13);1-2H3 |
| InChIKey | BQEQELVZAPQDGN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |