C15H23FN4O5 — CID 163906457
5-fluoro-N-[7-(hydroxyamino)-3,5,5-trimethyl-7-oxoheptan-3-yl]-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 163906457) has the molecular formula C15H23FN4O5 and a molecular weight of 358.37 g/mol. Its IUPAC name is 5-fluoro-N-[7-(hydroxyamino)-3,5,5-trimethyl-7-oxoheptan-3-yl]-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | 5-fluoro-N-[7-(hydroxyamino)-3,5,5-trimethyl-7-oxoheptan-3-yl]-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 163906457 |
| Molecular Formula | C15H23FN4O5 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 5-fluoro-N-[7-(hydroxyamino)-3,5,5-trimethyl-7-oxoheptan-3-yl]-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | CCC(C)(CC(C)(C)CC(=O)NO)NC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H23FN4O5/c1-5-15(4,8-14(2,3)6-10(21)19-25)18-13(24)20-7-9(16)11(22)17-12(20)23/h7,25H,5-6,8H2,1-4H3,(H,18,24)(H,19,21)(H,17,22,23) |
| InChIKey | QOIDUDVOATWZIA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|