C13H18FN3O3 — CID 10540930
N-(1-cyclohexylethyl)-5-fluoro-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 10540930) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is N-(1-cyclohexylethyl)-5-fluoro-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | N-(1-cyclohexylethyl)-5-fluoro-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 10540930 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-(1-cyclohexylethyl)-5-fluoro-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | CC(NC(=O)n1cc(F)c(=O)[nH]c1=O)C1CCCCC1 |
| InChI | InChI=1S/C13H18FN3O3/c1-8(9-5-3-2-4-6-9)15-12(19)17-7-10(14)11(18)16-13(17)20/h7-9H,2-6H2,1H3,(H,15,19)(H,16,18,20) |
| InChIKey | KHMYXYKNZVIVMD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |