C15H18F3NO — CID 63189611
N-(1-cyclohexylethyl)-3,4,5-trifluorobenzamide (PubChem CID 63189611) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is N-(1-cyclohexylethyl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(1-cyclohexylethyl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 63189611 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-(1-cyclohexylethyl)-3,4,5-trifluorobenzamide |
| SMILES | CC(NC(=O)c1cc(F)c(F)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H18F3NO/c1-9(10-5-3-2-4-6-10)19-15(20)11-7-12(16)14(18)13(17)8-11/h7-10H,2-6H2,1H3,(H,19,20) |
| InChIKey | UTABYZKIRQDHAK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|