C30H40N2O2 — CID 132596984
N-[(1S)-1-cyclohexylethyl]-4-[4-[[(1S)-1-cyclohexylethyl]carbamoyl]phenyl]benzamide (PubChem CID 132596984) has the molecular formula C30H40N2O2 and a molecular weight of 460.66 g/mol. Its IUPAC name is N-[(1S)-1-cyclohexylethyl]-4-[4-[[(1S)-1-cyclohexylethyl]carbamoyl]phenyl]benzamide.
| Compound Name | N-[(1S)-1-cyclohexylethyl]-4-[4-[[(1S)-1-cyclohexylethyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 132596984 |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | N-[(1S)-1-cyclohexylethyl]-4-[4-[[(1S)-1-cyclohexylethyl]carbamoyl]phenyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(-c2ccc(C(=O)N[C@@H](C)C3CCCCC3)cc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C30H40N2O2/c1-21(23-9-5-3-6-10-23)31-29(33)27-17-13-25(14-18-27)26-15-19-28(20-16-26)30(34)32-22(2)24-11-7-4-8-12-24/h13-24H,3-12H2,1-2H3,(H,31,33)(H,32,34)/t21-,22-/m0/s1 |
| InChIKey | NIDXMQIJXHXPHP-VXKWHMMOSA-N |
| XLogP | 6.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |