C16H20FN3O3 — CID 20525096
N-(1-adamantylmethyl)-5-fluoro-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 20525096) has the molecular formula C16H20FN3O3 and a molecular weight of 321.35 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-fluoro-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-5-fluoro-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 20525096 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-(1-adamantylmethyl)-5-fluoro-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H20FN3O3/c17-12-7-20(15(23)19-13(12)21)14(22)18-8-16-4-9-1-10(5-16)3-11(2-9)6-16/h7,9-11H,1-6,8H2,(H,18,22)(H,19,21,23) |
| InChIKey | HODIRPLYYZJHAZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |