C12H16FN3O4 — CID 10803042
5-fluoro-N-(3-methoxycyclohexyl)-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 10803042) has the molecular formula C12H16FN3O4 and a molecular weight of 285.27 g/mol. Its IUPAC name is 5-fluoro-N-(3-methoxycyclohexyl)-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | 5-fluoro-N-(3-methoxycyclohexyl)-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 10803042 |
| Molecular Formula | C12H16FN3O4 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-fluoro-N-(3-methoxycyclohexyl)-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | COC1CCCC(NC(=O)n2cc(F)c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C12H16FN3O4/c1-20-8-4-2-3-7(5-8)14-11(18)16-6-9(13)10(17)15-12(16)19/h6-8H,2-5H2,1H3,(H,14,18)(H,15,17,19) |
| InChIKey | ITMYSDBZVGGXMF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |