C12H10FN5O4 — CID 88642874
5-fluoro-2,4-dioxo-N-[(pyridine-3-carbonylamino)methyl]pyrimidine-1-carboxamide (PubChem CID 88642874) has the molecular formula C12H10FN5O4 and a molecular weight of 307.24 g/mol. Its IUPAC name is 5-fluoro-2,4-dioxo-N-[(pyridine-3-carbonylamino)methyl]pyrimidine-1-carboxamide.
| Compound Name | 5-fluoro-2,4-dioxo-N-[(pyridine-3-carbonylamino)methyl]pyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 88642874 |
| Molecular Formula | C12H10FN5O4 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-fluoro-2,4-dioxo-N-[(pyridine-3-carbonylamino)methyl]pyrimidine-1-carboxamide |
| SMILES | O=C(NCNC(=O)n1cc(F)c(=O)[nH]c1=O)c1cccnc1 |
| InChI | InChI=1S/C12H10FN5O4/c13-8-5-18(12(22)17-10(8)20)11(21)16-6-15-9(19)7-2-1-3-14-4-7/h1-5H,6H2,(H,15,19)(H,16,21)(H,17,20,22) |
| InChIKey | FNHIXMCAUAVBMX-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|