C19H20FN5O4 — CID 177371910
1-ethyl-N-[3-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]propyl]indole-2-carboxamide (PubChem CID 177371910) has the molecular formula C19H20FN5O4 and a molecular weight of 401.40 g/mol. Its IUPAC name is 1-ethyl-N-[3-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]propyl]indole-2-carboxamide.
| Compound Name | 1-ethyl-N-[3-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]propyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 177371910 |
| Molecular Formula | C19H20FN5O4 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-ethyl-N-[3-[(5-fluoro-2,4-dioxopyrimidine-1-carbonyl)amino]propyl]indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NCCCNC(=O)n2cc(F)c(=O)[nH]c2=O)cc2ccccc21 |
| InChI | InChI=1S/C19H20FN5O4/c1-2-24-14-7-4-3-6-12(14)10-15(24)17(27)21-8-5-9-22-18(28)25-11-13(20)16(26)23-19(25)29/h3-4,6-7,10-11H,2,5,8-9H2,1H3,(H,21,27)(H,22,28)(H,23,26,29) |
| InChIKey | SNJXBRHNYDZGKX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|