C11H17FN2O4 — CID 63629471
1-(3,3-diethoxypropyl)-5-fluoropyrimidine-2,4-dione (PubChem CID 63629471) has the molecular formula C11H17FN2O4 and a molecular weight of 260.26 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-(3,3-diethoxypropyl)-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63629471 |
| Molecular Formula | C11H17FN2O4 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(3,3-diethoxypropyl)-5-fluoropyrimidine-2,4-dione |
| SMILES | CCOC(CCn1cc(F)c(=O)[nH]c1=O)OCC |
| InChI | InChI=1S/C11H17FN2O4/c1-3-17-9(18-4-2)5-6-14-7-8(12)10(15)13-11(14)16/h7,9H,3-6H2,1-2H3,(H,13,15,16) |
| InChIKey | CLBYUUDHQYSTSE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|