C5H5FN2O3 — CID 164899020
5-fluoro-1-methoxypyrimidine-2,4-dione (PubChem CID 164899020) has the molecular formula C5H5FN2O3 and a molecular weight of 160.10 g/mol. Its IUPAC name is 5-fluoro-1-methoxypyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-methoxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164899020 |
| Molecular Formula | C5H5FN2O3 |
| Molecular Weight | 160.10 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 5-fluoro-1-methoxypyrimidine-2,4-dione |
| SMILES | COn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H5FN2O3/c1-11-8-2-3(6)4(9)7-5(8)10/h2H,1H3,(H,7,9,10) |
| InChIKey | KAFBBGRQCIRICZ-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.10 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |