C10H13FN2O3 — CID 15060444
5-fluoro-1-(1-prop-2-enoxypropyl)pyrimidine-2,4-dione (PubChem CID 15060444) has the molecular formula C10H13FN2O3 and a molecular weight of 228.22 g/mol. Its IUPAC name is 5-fluoro-1-(1-prop-2-enoxypropyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(1-prop-2-enoxypropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15060444 |
| Molecular Formula | C10H13FN2O3 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 5-fluoro-1-(1-prop-2-enoxypropyl)pyrimidine-2,4-dione |
| SMILES | C=CCOC(CC)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13FN2O3/c1-3-5-16-8(4-2)13-6-7(11)9(14)12-10(13)15/h3,6,8H,1,4-5H2,2H3,(H,12,14,15) |
| InChIKey | QOJLOBVYLSOHGT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|