C7H9FN2O2Si — CID 174987921
5-fluoro-1-prop-2-enylsilylpyrimidine-2,4-dione (PubChem CID 174987921) has the molecular formula C7H9FN2O2Si and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-fluoro-1-prop-2-enylsilylpyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-prop-2-enylsilylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174987921 |
| Molecular Formula | C7H9FN2O2Si |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 5-fluoro-1-prop-2-enylsilylpyrimidine-2,4-dione |
| SMILES | C=CC[SiH2]n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H9FN2O2Si/c1-2-3-13-10-4-5(8)6(11)9-7(10)12/h2,4H,1,3,13H2,(H,9,11,12) |
| InChIKey | ZHTPMWIGKSXCIV-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|