C13H17N5O5 — CID 144509043
2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-[(1R)-1-hydroxyprop-2-enyl]-3-methyloxolan-2-yl]-1H-purin-6-one (PubChem CID 144509043) has the molecular formula C13H17N5O5 and a molecular weight of 323.31 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-[(1R)-1-hydroxyprop-2-enyl]-3-methyloxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-[(1R)-1-hydroxyprop-2-enyl]-3-methyloxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 144509043 |
| Molecular Formula | C13H17N5O5 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-[(1R)-1-hydroxyprop-2-enyl]-3-methyloxolan-2-yl]-1H-purin-6-one |
| SMILES | C=C[C@@H](O)[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C13H17N5O5/c1-3-5(19)7-8(20)13(2,22)11(23-7)18-4-15-6-9(18)16-12(14)17-10(6)21/h3-5,7-8,11,19-20,22H,1H2,2H3,(H3,14,16,17,21)/t5-,7-,8-,11-,13-/m1/s1 |
| InChIKey | XOEWCIIPZYJBNW-DJOSKTDSSA-N |
| XLogP | -1.74 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|