C12H17N5O2 — CID 135439454
2-amino-9-[(1R,2R)-2-hydroxycycloheptyl]-1H-purin-6-one (PubChem CID 135439454) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-amino-9-[(1R,2R)-2-hydroxycycloheptyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R,2R)-2-hydroxycycloheptyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135439454 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-amino-9-[(1R,2R)-2-hydroxycycloheptyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2CCCCC[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C12H17N5O2/c13-12-15-10-9(11(19)16-12)14-6-17(10)7-4-2-1-3-5-8(7)18/h6-8,18H,1-5H2,(H3,13,15,16,19)/t7-,8-/m1/s1 |
| InChIKey | IHWQEXLPKCVXEM-HTQZYQBOSA-N |
| XLogP | 0.57 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |