C16H27N5O2Si — CID 135610882
2-amino-9-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-1H-purin-6-one (PubChem CID 135610882) has the molecular formula C16H27N5O2Si and a molecular weight of 349.51 g/mol. Its IUPAC name is 2-amino-9-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135610882 |
| Molecular Formula | C16H27N5O2Si |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-amino-9-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C16H27N5O2Si/c1-16(2,3)24(4,5)23-11-8-6-7-10(11)21-9-18-12-13(21)19-15(17)20-14(12)22/h9-11H,6-8H2,1-5H3,(H3,17,19,20,22)/t10-,11-/m0/s1 |
| InChIKey | XLPROTZNONGLIU-QWRGUYRKSA-N |
| XLogP | 2.82 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|