C23H33N5O6SSi — CID 135897802
[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 135897802) has the molecular formula C23H33N5O6SSi and a molecular weight of 535.70 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135897802 |
| Molecular Formula | C23H33N5O6SSi |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)C[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H33N5O6SSi/c1-14-7-9-15(10-8-14)35(30,31)32-12-17-16(34-36(5,6)23(2,3)4)11-18(33-17)28-13-25-19-20(28)26-22(24)27-21(19)29/h7-10,13,16-18H,11-12H2,1-6H3,(H3,24,26,27,29)/t16-,17+,18+/m0/s1 |
| InChIKey | PYTCDQFFXQBTRF-RCCFBDPRSA-N |
| XLogP | 3.09 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|