C31H30N4O7S2 — CID 101349845
[(2R,3S,5R)-5-[6-(4-methylphenyl)purin-9-yl]-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 101349845) has the molecular formula C31H30N4O7S2 and a molecular weight of 634.74 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[6-(4-methylphenyl)purin-9-yl]-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,5R)-5-[6-(4-methylphenyl)purin-9-yl]-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101349845 |
| Molecular Formula | C31H30N4O7S2 |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | [(2R,3S,5R)-5-[6-(4-methylphenyl)purin-9-yl]-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(-c2ncnc3c2ncn3[C@H]2C[C@H](OS(=O)(=O)c3ccc(C)cc3)[C@@H](COS(=O)(=O)c3ccc(C)cc3)O2)cc1 |
| InChI | InChI=1S/C31H30N4O7S2/c1-20-4-10-23(11-5-20)29-30-31(33-18-32-29)35(19-34-30)28-16-26(42-44(38,39)25-14-8-22(3)9-15-25)27(41-28)17-40-43(36,37)24-12-6-21(2)7-13-24/h4-15,18-19,26-28H,16-17H2,1-3H3/t26-,27+,28+/m0/s1 |
| InChIKey | GEFQNEMZJCMJLV-UPRLRBBYSA-N |
| XLogP | 4.89 |
| TPSA | 139.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|