C18H17N5O6S — CID 98515004
[(1S,2R,4R,5R)-4-(6-formamidopurin-9-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 98515004) has the molecular formula C18H17N5O6S and a molecular weight of 431.43 g/mol. Its IUPAC name is [(1S,2R,4R,5R)-4-(6-formamidopurin-9-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,4R,5R)-4-(6-formamidopurin-9-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 98515004 |
| Molecular Formula | C18H17N5O6S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [(1S,2R,4R,5R)-4-(6-formamidopurin-9-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H](n3cnc4c(NC=O)ncnc43)[C@@H]3O[C@H]32)cc1 |
| InChI | InChI=1S/C18H17N5O6S/c1-10-2-4-11(5-3-10)30(25,26)27-6-12-14-15(29-14)18(28-12)23-8-21-13-16(22-9-24)19-7-20-17(13)23/h2-5,7-9,12,14-15,18H,6H2,1H3,(H,19,20,22,24)/t12-,14+,15-,18-/m1/s1 |
| InChIKey | LJLCVUZMQYFZSY-MJXUCMMTSA-N |
| XLogP | 0.77 |
| TPSA | 137.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|