C24H33N5O5Si — CID 135531302
9-[(2R,4aR,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2-amino-1H-purin-6-one (PubChem CID 135531302) has the molecular formula C24H33N5O5Si and a molecular weight of 499.64 g/mol. Its IUPAC name is 9-[(2R,4aR,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2-amino-1H-purin-6-one.
| Compound Name | 9-[(2R,4aR,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2-amino-1H-purin-6-one |
|---|---|
| PubChem CID | 135531302 |
| Molecular Formula | C24H33N5O5Si |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 9-[(2R,4aR,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2-amino-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H]2O[C@H](c3ccccc3)OC[C@H]2OC[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C24H33N5O5Si/c1-24(2,3)35(4,5)34-18-15(29-13-26-17-20(29)27-23(25)28-21(17)30)11-31-16-12-32-22(33-19(16)18)14-9-7-6-8-10-14/h6-10,13,15-16,18-19,22H,11-12H2,1-5H3,(H3,25,27,28,30)/t15-,16-,18-,19-,22-/m1/s1 |
| InChIKey | WSDXDUKYZHVEFL-FBLYDNEXSA-N |
| XLogP | 3.15 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|