C11H16N6O6P+ — CID 137160075
[2-[(3S,4R)-3-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]-trihydroxyphosphanium (PubChem CID 137160075) has the molecular formula C11H16N6O6P+ and a molecular weight of 359.26 g/mol. Its IUPAC name is [2-[(3S,4R)-3-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]-trihydroxyphosphanium.
| Compound Name | [2-[(3S,4R)-3-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 137160075 |
| Molecular Formula | C11H16N6O6P+ |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | [2-[(3S,4R)-3-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]-trihydroxyphosphanium |
| SMILES | Nc1nc2c(ncn2[C@H]2CN(C(=O)C[P+](O)(O)O)C[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N6O6P/c12-11-14-9-8(10(20)15-11)13-4-17(9)5-1-16(2-6(5)18)7(19)3-24(21,22)23/h4-6,18,21-23H,1-3H2,(H2-,12,14,15,20)/p+1/t5-,6+/m0/s1 |
| InChIKey | XXUNJVUDIBRIMK-NTSWFWBYSA-O |
| XLogP | -2.81 |
| TPSA | 190.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|