C11H15N5O3 — CID 135548411
2-amino-9-[3-(hydroxymethyl)cyclopent-3-en-1-yl]-1H-purin-6-one;hydrate (PubChem CID 135548411) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-amino-9-[3-(hydroxymethyl)cyclopent-3-en-1-yl]-1H-purin-6-one;hydrate.
| Compound Name | 2-amino-9-[3-(hydroxymethyl)cyclopent-3-en-1-yl]-1H-purin-6-one;hydrate |
|---|---|
| PubChem CID | 135548411 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-amino-9-[3-(hydroxymethyl)cyclopent-3-en-1-yl]-1H-purin-6-one;hydrate |
| SMILES | Nc1nc2c(ncn2C2CC=C(CO)C2)c(=O)[nH]1.O |
| InChI | InChI=1S/C11H13N5O2.H2O/c12-11-14-9-8(10(18)15-11)13-5-16(9)7-2-1-6(3-7)4-17;/h1,5,7,17H,2-4H2,(H3,12,14,15,18);1H2 |
| InChIKey | KYOKROJFVOCUPB-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 141.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|