C7H16N7O6P — CID 173340491
(2-amino-6-oxo-1H-purin-9-yl)oxymethoxymethylphosphonic acid;azane (PubChem CID 173340491) has the molecular formula C7H16N7O6P and a molecular weight of 325.22 g/mol. Its IUPAC name is (2-amino-6-oxo-1H-purin-9-yl)oxymethoxymethylphosphonic acid;azane.
| Compound Name | (2-amino-6-oxo-1H-purin-9-yl)oxymethoxymethylphosphonic acid;azane |
|---|---|
| PubChem CID | 173340491 |
| Molecular Formula | C7H16N7O6P |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (2-amino-6-oxo-1H-purin-9-yl)oxymethoxymethylphosphonic acid;azane |
| SMILES | N.N.Nc1nc2c(ncn2OCOCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C7H10N5O6P.2H3N/c8-7-10-5-4(6(13)11-7)9-1-12(5)18-2-17-3-19(14,15)16;;/h1H,2-3H2,(H2,14,15,16)(H3,8,10,11,13);2*1H3 |
| InChIKey | RKGLAPKRRDYDOB-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 235.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|