C7H11N6O5P — CID 135435074
2-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)ethoxymethylphosphonic acid (PubChem CID 135435074) has the molecular formula C7H11N6O5P and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)ethoxymethylphosphonic acid.
| Compound Name | 2-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 135435074 |
| Molecular Formula | C7H11N6O5P |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)ethoxymethylphosphonic acid |
| SMILES | Nc1nc2c(nnn2CCOCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C7H11N6O5P/c8-7-9-5-4(6(14)10-7)11-12-13(5)1-2-18-3-19(15,16)17/h1-3H2,(H2,15,16,17)(H3,8,9,10,14) |
| InChIKey | CHRXWGRDHXPNLI-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 169.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|