C11H19N6O4P — CID 135528661
5-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)pentyl-ethoxyphosphinic acid (PubChem CID 135528661) has the molecular formula C11H19N6O4P and a molecular weight of 330.29 g/mol. Its IUPAC name is 5-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)pentyl-ethoxyphosphinic acid.
| Compound Name | 5-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)pentyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 135528661 |
| Molecular Formula | C11H19N6O4P |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)pentyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)CCCCCn1nnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H19N6O4P/c1-2-21-22(19,20)7-5-3-4-6-17-9-8(15-16-17)10(18)14-11(12)13-9/h2-7H2,1H3,(H,19,20)(H3,12,13,14,18) |
| InChIKey | VSEMFCKWHIEDMI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|