C17H29N6O6P — CID 136623210
ethyl 2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethyl-(2-diethoxyphosphorylethyl)amino]acetate (PubChem CID 136623210) has the molecular formula C17H29N6O6P and a molecular weight of 444.43 g/mol. Its IUPAC name is ethyl 2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethyl-(2-diethoxyphosphorylethyl)amino]acetate.
| Compound Name | ethyl 2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethyl-(2-diethoxyphosphorylethyl)amino]acetate |
|---|---|
| PubChem CID | 136623210 |
| Molecular Formula | C17H29N6O6P |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | ethyl 2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethyl-(2-diethoxyphosphorylethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCn1cnc2c(=O)[nH]c(N)nc21)CCP(=O)(OCC)OCC |
| InChI | InChI=1S/C17H29N6O6P/c1-4-27-13(24)11-22(9-10-30(26,28-5-2)29-6-3)7-8-23-12-19-14-15(23)20-17(18)21-16(14)25/h12H,4-11H2,1-3H3,(H3,18,20,21,25) |
| InChIKey | XTRLRNWXMXCCSN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|