C8H12N5O5P — CID 135542239
2-(2-amino-6-oxo-1H-purin-7-yl)ethoxymethylphosphonic acid (PubChem CID 135542239) has the molecular formula C8H12N5O5P and a molecular weight of 289.19 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-1H-purin-7-yl)ethoxymethylphosphonic acid.
| Compound Name | 2-(2-amino-6-oxo-1H-purin-7-yl)ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 135542239 |
| Molecular Formula | C8H12N5O5P |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-(2-amino-6-oxo-1H-purin-7-yl)ethoxymethylphosphonic acid |
| SMILES | Nc1nc2ncn(CCOCP(=O)(O)O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N5O5P/c9-8-11-6-5(7(14)12-8)13(3-10-6)1-2-18-4-19(15,16)17/h3H,1-2,4H2,(H2,15,16,17)(H3,9,11,12,14) |
| InChIKey | HIANPONULDPAKP-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|