C11H16N6O3S — CID 135743909
methyl (2R)-2-amino-3-[2-(2-amino-6-oxo-1H-purin-7-yl)ethylsulfanyl]propanoate (PubChem CID 135743909) has the molecular formula C11H16N6O3S and a molecular weight of 312.36 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-[2-(2-amino-6-oxo-1H-purin-7-yl)ethylsulfanyl]propanoate.
| Compound Name | methyl (2R)-2-amino-3-[2-(2-amino-6-oxo-1H-purin-7-yl)ethylsulfanyl]propanoate |
|---|---|
| PubChem CID | 135743909 |
| Molecular Formula | C11H16N6O3S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | methyl (2R)-2-amino-3-[2-(2-amino-6-oxo-1H-purin-7-yl)ethylsulfanyl]propanoate |
| SMILES | COC(=O)[C@@H](N)CSCCn1cnc2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C11H16N6O3S/c1-20-10(19)6(12)4-21-3-2-17-5-14-8-7(17)9(18)16-11(13)15-8/h5-6H,2-4,12H2,1H3,(H3,13,15,16,18)/t6-/m0/s1 |
| InChIKey | RSAGRKNNJQJKSL-LURJTMIESA-N |
| XLogP | -1.06 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|