C12H16N6O4S — CID 135526601
(2R)-2-acetamido-3-[2-(2-amino-6-oxo-1H-purin-7-yl)ethylsulfanyl]propanoic acid (PubChem CID 135526601) has the molecular formula C12H16N6O4S and a molecular weight of 340.37 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[2-(2-amino-6-oxo-1H-purin-7-yl)ethylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[2-(2-amino-6-oxo-1H-purin-7-yl)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 135526601 |
| Molecular Formula | C12H16N6O4S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (2R)-2-acetamido-3-[2-(2-amino-6-oxo-1H-purin-7-yl)ethylsulfanyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCCn1cnc2nc(N)[nH]c(=O)c21)C(=O)O |
| InChI | InChI=1S/C12H16N6O4S/c1-6(19)15-7(11(21)22)4-23-3-2-18-5-14-9-8(18)10(20)17-12(13)16-9/h5,7H,2-4H2,1H3,(H,15,19)(H,21,22)(H3,13,16,17,20)/t7-/m0/s1 |
| InChIKey | QTHQULFDYKSQCN-ZETCQYMHSA-N |
| XLogP | -0.98 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|