C10H16N6O3 — CID 135488878
2-amino-7-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]-1H-purin-6-one (PubChem CID 135488878) has the molecular formula C10H16N6O3 and a molecular weight of 268.28 g/mol. Its IUPAC name is 2-amino-7-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-7-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135488878 |
| Molecular Formula | C10H16N6O3 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-amino-7-[2-(1,3-dihydroxypropan-2-ylamino)ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2ncn(CCNC(CO)CO)c2c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N6O3/c11-10-14-8-7(9(19)15-10)16(5-13-8)2-1-12-6(3-17)4-18/h5-6,12,17-18H,1-4H2,(H3,11,14,15,19) |
| InChIKey | XYCDSKWPYZSIDU-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |