C9H14N6O3 — CID 135779127
2-amino-7-[(1-amino-3-hydroxypropan-2-yl)oxymethyl]-1H-purin-6-one (PubChem CID 135779127) has the molecular formula C9H14N6O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-amino-7-[(1-amino-3-hydroxypropan-2-yl)oxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-7-[(1-amino-3-hydroxypropan-2-yl)oxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135779127 |
| Molecular Formula | C9H14N6O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-amino-7-[(1-amino-3-hydroxypropan-2-yl)oxymethyl]-1H-purin-6-one |
| SMILES | NCC(CO)OCn1cnc2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C9H14N6O3/c10-1-5(2-16)18-4-15-3-12-7-6(15)8(17)14-9(11)13-7/h3,5,16H,1-2,4,10H2,(H3,11,13,14,17) |
| InChIKey | VMSQLMODPJDKSQ-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |