C8H9N5O3 — CID 136707556
methyl 2-(2-amino-6-oxo-1H-purin-7-yl)acetate (PubChem CID 136707556) has the molecular formula C8H9N5O3 and a molecular weight of 223.19 g/mol. Its IUPAC name is methyl 2-(2-amino-6-oxo-1H-purin-7-yl)acetate.
| Compound Name | methyl 2-(2-amino-6-oxo-1H-purin-7-yl)acetate |
|---|---|
| PubChem CID | 136707556 |
| Molecular Formula | C8H9N5O3 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | methyl 2-(2-amino-6-oxo-1H-purin-7-yl)acetate |
| SMILES | COC(=O)Cn1cnc2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C8H9N5O3/c1-16-4(14)2-13-3-10-6-5(13)7(15)12-8(9)11-6/h3H,2H2,1H3,(H3,9,11,12,15) |
| InChIKey | DQQLXXKKUYHTCD-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |