C12H21N5O6P2 — CID 135503760
[6-(2-amino-6-oxo-1H-purin-7-yl)hexyl-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 135503760) has the molecular formula C12H21N5O6P2 and a molecular weight of 393.28 g/mol. Its IUPAC name is [6-(2-amino-6-oxo-1H-purin-7-yl)hexyl-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [6-(2-amino-6-oxo-1H-purin-7-yl)hexyl-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 135503760 |
| Molecular Formula | C12H21N5O6P2 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [6-(2-amino-6-oxo-1H-purin-7-yl)hexyl-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | Nc1nc2ncn(CCCCCCP(=O)(O)CP(=O)(O)O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H21N5O6P2/c13-12-15-10-9(11(18)16-12)17(7-14-10)5-3-1-2-4-6-24(19,20)8-25(21,22)23/h7H,1-6,8H2,(H,19,20)(H2,21,22,23)(H3,13,15,16,18) |
| InChIKey | LXXLYVIHQJXDSP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 184.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|