C18H25N5O3 — CID 137211616
2-amino-7-[7-oxo-7-(2-oxocyclohexyl)heptyl]-1H-purin-6-one (PubChem CID 137211616) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-amino-7-[7-oxo-7-(2-oxocyclohexyl)heptyl]-1H-purin-6-one.
| Compound Name | 2-amino-7-[7-oxo-7-(2-oxocyclohexyl)heptyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137211616 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2-amino-7-[7-oxo-7-(2-oxocyclohexyl)heptyl]-1H-purin-6-one |
| SMILES | Nc1nc2ncn(CCCCCCC(=O)C3CCCCC3=O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C18H25N5O3/c19-18-21-16-15(17(26)22-18)23(11-20-16)10-6-2-1-3-8-13(24)12-7-4-5-9-14(12)25/h11-12H,1-10H2,(H3,19,21,22,26) |
| InChIKey | DKDVHIJOVZFDIQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|