C19H22ClN15O4 — CID 174568361
2-amino-7-(2-chloroethyl)-1H-purin-6-one;2-amino-1,7-dihydropurin-6-one;2-amino-7-(2-hydroxyethyl)-1H-purin-6-one (PubChem CID 174568361) has the molecular formula C19H22ClN15O4 and a molecular weight of 559.94 g/mol. Its IUPAC name is 2-amino-7-(2-chloroethyl)-1H-purin-6-one;2-amino-1,7-dihydropurin-6-one;2-amino-7-(2-hydroxyethyl)-1H-purin-6-one.
| Compound Name | 2-amino-7-(2-chloroethyl)-1H-purin-6-one;2-amino-1,7-dihydropurin-6-one;2-amino-7-(2-hydroxyethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 174568361 |
| Molecular Formula | C19H22ClN15O4 |
| Molecular Weight | 559.94 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 2-amino-7-(2-chloroethyl)-1H-purin-6-one;2-amino-1,7-dihydropurin-6-one;2-amino-7-(2-hydroxyethyl)-1H-purin-6-one |
| SMILES | Nc1nc2nc[nH]c2c(=O)[nH]1.Nc1nc2ncn(CCCl)c2c(=O)[nH]1.Nc1nc2ncn(CCO)c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H8ClN5O.C7H9N5O2.C5H5N5O/c8-1-2-13-3-10-5-4(13)6(14)12-7(9)11-5;8-7-10-5-4(6(14)11-7)12(1-2-13)3-9-5;6-5-9-3-2(4(11)10-5)7-1-8-3/h3H,1-2H2,(H3,9,11,12,14);3,13H,1-2H2,(H3,8,10,11,14);1H,(H4,6,7,8,9,10,11) |
| InChIKey | QQLMWQFHCIRTEY-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 299.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.94 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|