C14H16N8O5 — CID 160857358
7-(2-hydroxyethyl)-3-methylpurine-2,6-dione;3-methyl-7H-purine-2,6-dione (PubChem CID 160857358) has the molecular formula C14H16N8O5 and a molecular weight of 376.33 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-3-methylpurine-2,6-dione;3-methyl-7H-purine-2,6-dione.
| Compound Name | 7-(2-hydroxyethyl)-3-methylpurine-2,6-dione;3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 160857358 |
| Molecular Formula | C14H16N8O5 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 7-(2-hydroxyethyl)-3-methylpurine-2,6-dione;3-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]cnc21.Cn1c(=O)[nH]c(=O)c2c1ncn2CCO |
| InChI | InChI=1S/C8H10N4O3.C6H6N4O2/c1-11-6-5(7(14)10-8(11)15)12(2-3-13)4-9-6;1-10-4-3(7-2-8-4)5(11)9-6(10)12/h4,13H,2-3H2,1H3,(H,10,14,15);2H,1H3,(H,7,8)(H,9,11,12) |
| InChIKey | SKAMTGBOAOMPLS-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 176.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |