C12H16N4O4 — CID 102157464
(3-methyl-2,6-dioxopurin-7-yl)methyl 2,2-dimethylpropanoate (PubChem CID 102157464) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is (3-methyl-2,6-dioxopurin-7-yl)methyl 2,2-dimethylpropanoate.
| Compound Name | (3-methyl-2,6-dioxopurin-7-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102157464 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (3-methyl-2,6-dioxopurin-7-yl)methyl 2,2-dimethylpropanoate |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1ncn2COC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H16N4O4/c1-12(2,3)10(18)20-6-16-5-13-8-7(16)9(17)14-11(19)15(8)4/h5H,6H2,1-4H3,(H,14,17,19) |
| InChIKey | QWBATCASEXLNLA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |