C14H20N4O4 — CID 57281914
(2,6-dioxo-1-propyl-3H-purin-9-yl)methyl 2,2-dimethylpropanoate (PubChem CID 57281914) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is (2,6-dioxo-1-propyl-3H-purin-9-yl)methyl 2,2-dimethylpropanoate.
| Compound Name | (2,6-dioxo-1-propyl-3H-purin-9-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57281914 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2,6-dioxo-1-propyl-3H-purin-9-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CCCn1c(=O)[nH]c2c(ncn2COC(=O)C(C)(C)C)c1=O |
| InChI | InChI=1S/C14H20N4O4/c1-5-6-18-11(19)9-10(16-13(18)21)17(7-15-9)8-22-12(20)14(2,3)4/h7H,5-6,8H2,1-4H3,(H,16,21) |
| InChIKey | PGVDEEHGQOTRNG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |