C9H11N4NaO4 — CID 23689356
sodium;3,7-dimethylpurine-2,6-dione;acetate (PubChem CID 23689356) has the molecular formula C9H11N4NaO4 and a molecular weight of 262.20 g/mol. Its IUPAC name is sodium;3,7-dimethylpurine-2,6-dione;acetate.
| Compound Name | sodium;3,7-dimethylpurine-2,6-dione;acetate |
|---|---|
| PubChem CID | 23689356 |
| Molecular Formula | C9H11N4NaO4 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | sodium;3,7-dimethylpurine-2,6-dione;acetate |
| SMILES | CC(=O)[O-].Cn1cnc2c1c(=O)[nH]c(=O)n2C.[Na+] |
| InChI | InChI=1S/C7H8N4O2.C2H4O2.Na/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2;1-2(3)4;/h3H,1-2H3,(H,9,12,13);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | TYIPBFCVIBTJOV-UHFFFAOYSA-M |
| XLogP | -5.28 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | -5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |