About sodium;3,7-dimethylpurine-2,6-dione;acetate
sodium;3,7-dimethylpurine-2,6-dione;acetate (PubChem CID 23689356) has the molecular formula C9H11N4NaO4
and a molecular weight of 262.20 g/mol. Its IUPAC name is sodium;3,7-dimethylpurine-2,6-dione;acetate.
Molecular Properties
| Compound Name | sodium;3,7-dimethylpurine-2,6-dione;acetate |
| PubChem CID | 23689356 |
| Molecular Formula | C9H11N4NaO4 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | sodium;3,7-dimethylpurine-2,6-dione;acetate |
| SMILES | CC(=O)[O-].Cn1cnc2c1c(=O)[nH]c(=O)n2C.[Na+] |
| InChI | InChI=1S/C7H8N4O2.C2H4O2.Na/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2;1-2(3)4;/h3H,1-2H3,(H,9,12,13);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | TYIPBFCVIBTJOV-UHFFFAOYSA-M |
| XLogP | -5.28 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | -5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze sodium;3,7-dimethylpurine-2,6-dione;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3,7-dimethylpurine-2,6-dione;acetate?
The IUPAC name of sodium;3,7-dimethylpurine-2,6-dione;acetate (CID 23689356) is sodium;3,7-dimethylpurine-2,6-dione;acetate.
What is the SMILES notation for sodium;3,7-dimethylpurine-2,6-dione;acetate?
The canonical SMILES for sodium;3,7-dimethylpurine-2,6-dione;acetate is CC(=O)[O-].Cn1cnc2c1c(=O)[nH]c(=O)n2C.[Na+].
What is the InChIKey of sodium;3,7-dimethylpurine-2,6-dione;acetate?
The InChIKey is TYIPBFCVIBTJOV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8N4O2.C2H4O2.Na/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2;1-2(3)4;/h3H,1-2H3,(H,9,12,13);1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;3,7-dimethylpurine-2,6-dione;acetate?
sodium;3,7-dimethylpurine-2,6-dione;acetate has a molecular weight of 262.20 g/mol, XLogP of -5.28, 0 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3,7-dimethylpurine-2,6-dione;acetate is sourced from PubChem (CID 23689356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).