C7H7ClN4O2 — CID 150670928
3-(chloromethyl)-7-methylpurine-2,6-dione (PubChem CID 150670928) has the molecular formula C7H7ClN4O2 and a molecular weight of 214.61 g/mol. Its IUPAC name is 3-(chloromethyl)-7-methylpurine-2,6-dione.
| Compound Name | 3-(chloromethyl)-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 150670928 |
| Molecular Formula | C7H7ClN4O2 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 3-(chloromethyl)-7-methylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)[nH]c(=O)n2CCl |
| InChI | InChI=1S/C7H7ClN4O2/c1-11-3-9-5-4(11)6(13)10-7(14)12(5)2-8/h3H,2H2,1H3,(H,10,13,14) |
| InChIKey | JFVZEJFXRXYJOM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|