C12H19N5O3 — CID 82465650
7-(3-aminopropyl)-3-(3-methoxypropyl)purine-2,6-dione (PubChem CID 82465650) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 7-(3-aminopropyl)-3-(3-methoxypropyl)purine-2,6-dione.
| Compound Name | 7-(3-aminopropyl)-3-(3-methoxypropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 82465650 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 7-(3-aminopropyl)-3-(3-methoxypropyl)purine-2,6-dione |
| SMILES | COCCCn1c(=O)[nH]c(=O)c2c1ncn2CCCN |
| InChI | InChI=1S/C12H19N5O3/c1-20-7-3-6-17-10-9(11(18)15-12(17)19)16(8-14-10)5-2-4-13/h8H,2-7,13H2,1H3,(H,15,18,19) |
| InChIKey | XGGCIXVXBIQOHF-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|