C8H10KN4O2 — CID 70394706
CID 70394706 (PubChem CID 70394706) has the molecular formula C8H10KN4O2 and a molecular weight of 233.29 g/mol.
| Compound Name | CID 70394706 |
|---|---|
| PubChem CID | 70394706 |
| Molecular Formula | C8H10KN4O2 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | — |
| SMILES | CCn1c(=O)[nH]c(=O)c2c1ncn2C.[K] |
| InChI | InChI=1S/C8H10N4O2.K/c1-3-12-6-5(11(2)4-9-6)7(13)10-8(12)14;/h4H,3H2,1-2H3,(H,10,13,14); |
| InChIKey | RYKFANSQAMKXPK-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |