C15H22N4O4 — CID 159580194
7-methyl-3-[5-(2-methyl-1,3-dioxolan-2-yl)pentyl]purine-2,6-dione (PubChem CID 159580194) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 7-methyl-3-[5-(2-methyl-1,3-dioxolan-2-yl)pentyl]purine-2,6-dione.
| Compound Name | 7-methyl-3-[5-(2-methyl-1,3-dioxolan-2-yl)pentyl]purine-2,6-dione |
|---|---|
| PubChem CID | 159580194 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 7-methyl-3-[5-(2-methyl-1,3-dioxolan-2-yl)pentyl]purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)[nH]c(=O)n2CCCCCC1(C)OCCO1 |
| InChI | InChI=1S/C15H22N4O4/c1-15(22-8-9-23-15)6-4-3-5-7-19-12-11(18(2)10-16-12)13(20)17-14(19)21/h10H,3-9H2,1-2H3,(H,17,20,21) |
| InChIKey | MIXNGYIDSURMOK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|